C23H46N6O2 — CID 110039701
2-[[(2-ethylhexylamino)-[[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110039701) has the molecular formula C23H46N6O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 2-[[(2-ethylhexylamino)-[[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-ethylhexylamino)-[[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110039701 |
| Molecular Formula | C23H46N6O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 2-[[(2-ethylhexylamino)-[[1-[2-oxo-2-(propylamino)ethyl]piperidin-4-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)NC1CCN(CC(=O)NCCC)CC1 |
| InChI | InChI=1S/C23H46N6O2/c1-6-9-10-19(8-3)16-25-23(26-17-22(31)28(4)5)27-20-11-14-29(15-12-20)18-21(30)24-13-7-2/h19-20H,6-18H2,1-5H3,(H,24,30)(H2,25,26,27) |
| InChIKey | WISDOVZHTYDMKB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|