C18H32N8O2 — CID 110043325
N,N-dimethyl-2-[[[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide (PubChem CID 110043325) has the molecular formula C18H32N8O2 and a molecular weight of 392.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110043325 |
| Molecular Formula | C18H32N8O2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | N,N-dimethyl-2-[[[(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)amino]-(2-morpholin-4-ylethylamino)methylidene]amino]acetamide |
| SMILES | Cc1nc2n(n1)CCCC2N/C(=N/CC(=O)N(C)C)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H32N8O2/c1-14-21-17-15(5-4-7-26(17)23-14)22-18(20-13-16(27)24(2)3)19-6-8-25-9-11-28-12-10-25/h15H,4-13H2,1-3H3,(H2,19,20,22) |
| InChIKey | FQWFYFNFMQQXFK-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|