C22H42IN7O2 — CID 109390733
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 109390733) has the molecular formula C22H42IN7O2 and a molecular weight of 563.53 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109390733 |
| Molecular Formula | C22H42IN7O2 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-2,2-diethylcyclobutyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CCOC1CC(N/C(=N/Cc2nnc(C)n2C)NCCN2CCOCC2)C1(CC)CC.I |
| InChI | InChI=1S/C22H41N7O2.HI/c1-6-22(7-2)18(15-19(22)31-8-3)25-21(23-9-10-29-11-13-30-14-12-29)24-16-20-27-26-17(4)28(20)5;/h18-19H,6-16H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | VRJHQFVWPCOJFL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|