C19H34N6O — CID 109390476
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-2,2-diethylcyclobutyl)-3-prop-2-enylguanidine (PubChem CID 109390476) has the molecular formula C19H34N6O and a molecular weight of 362.52 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-2,2-diethylcyclobutyl)-3-prop-2-enylguanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-2,2-diethylcyclobutyl)-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 109390476 |
| Molecular Formula | C19H34N6O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxy-2,2-diethylcyclobutyl)-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NC1CC(OCC)C1(CC)CC |
| InChI | InChI=1S/C19H34N6O/c1-7-11-20-18(21-13-17-24-23-14(5)25(17)6)22-15-12-16(26-10-4)19(15,8-2)9-3/h7,15-16H,1,8-13H2,2-6H3,(H2,20,21,22) |
| InChIKey | CLCWFDCRHAVVQC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|