C23H37IN6O — CID 109390349
2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxy-2,2-diethylcyclobutyl)guanidine;hydroiodide (PubChem CID 109390349) has the molecular formula C23H37IN6O and a molecular weight of 540.49 g/mol. Its IUPAC name is 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxy-2,2-diethylcyclobutyl)guanidine;hydroiodide.
| Compound Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxy-2,2-diethylcyclobutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109390349 |
| Molecular Formula | C23H37IN6O |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxy-2,2-diethylcyclobutyl)guanidine;hydroiodide |
| SMILES | CCOC1CC(N/C(=N/Cc2ccccc2)NCc2nnc(C)n2C)C1(CC)CC.I |
| InChI | InChI=1S/C23H36N6O.HI/c1-6-23(7-2)19(14-20(23)30-8-3)26-22(24-15-18-12-10-9-11-13-18)25-16-21-28-27-17(4)29(21)5;/h9-13,19-20H,6-8,14-16H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | IWMYRCFCTCOWNU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|