C17H28IN7O2 — CID 111491375
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111491375) has the molecular formula C17H28IN7O2 and a molecular weight of 489.36 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111491375 |
| Molecular Formula | C17H28IN7O2 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(/NCCN2CCOCC2)NCc2ccco2)n1C.I |
| InChI | InChI=1S/C17H27N7O2.HI/c1-14-21-22-16(23(14)2)13-20-17(19-12-15-4-3-9-26-15)18-5-6-24-7-10-25-11-8-24;/h3-4,9H,5-8,10-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | QSSWGFYUAVZBON-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|