C14H23IN6O2 — CID 111491377
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(furan-2-ylmethyl)-3-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 111491377) has the molecular formula C14H23IN6O2 and a molecular weight of 434.28 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(furan-2-ylmethyl)-3-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(furan-2-ylmethyl)-3-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111491377 |
| Molecular Formula | C14H23IN6O2 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(furan-2-ylmethyl)-3-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | COCCN/C(=N\Cc1nnc(C)n1C)NCc1ccco1.I |
| InChI | InChI=1S/C14H22N6O2.HI/c1-11-18-19-13(20(11)2)10-17-14(15-6-8-21-3)16-9-12-5-4-7-22-12;/h4-5,7H,6,8-10H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | JTBGXHDMTVHQOK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|