C21H32IN7O3 — CID 111777892
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111777892) has the molecular formula C21H32IN7O3 and a molecular weight of 557.44 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111777892 |
| Molecular Formula | C21H32IN7O3 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(/NCCc2ccc3c(c2)OCO3)NCCN2CCOCC2)n1C.I |
| InChI | InChI=1S/C21H31N7O3.HI/c1-16-25-26-20(27(16)2)14-24-21(23-7-8-28-9-11-29-12-10-28)22-6-5-17-3-4-18-19(13-17)31-15-30-18;/h3-4,13H,5-12,14-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | VFPICSZACVWUFO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|