C19H36N4O4 — CID 111775236
ethyl 4-[[N-ethyl-N'-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111775236) has the molecular formula C19H36N4O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111775236 |
| Molecular Formula | C19H36N4O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[3-(oxolan-3-ylmethoxy)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CCCOCC1CCOC1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H36N4O4/c1-3-20-18(21-9-5-12-25-14-16-8-13-26-15-16)22-17-6-10-23(11-7-17)19(24)27-4-2/h16-17H,3-15H2,1-2H3,(H2,20,21,22) |
| InChIKey | GNYNSLZCEPEVHO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|