C14H18O — CID 15689069
(6aR,10aR)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzoxepine (PubChem CID 15689069) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (6aR,10aR)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzoxepine.
| Compound Name | (6aR,10aR)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzoxepine |
|---|---|
| PubChem CID | 15689069 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (6aR,10aR)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzoxepine |
| SMILES | c1ccc2c(c1)C[C@H]1CCCC[C@H]1CO2 |
| InChI | InChI=1S/C14H18O/c1-2-7-13-10-15-14-8-4-3-6-12(14)9-11(13)5-1/h3-4,6,8,11,13H,1-2,5,7,9-10H2/t11-,13+/m1/s1 |
| InChIKey | VCNWTHYJTNBECH-YPMHNXCESA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |