C13H14O3 — CID 101442370
(4aS,11aR)-1,4,4a,5,11,11a-hexahydropyrano[4,3-c][1]benzoxepin-3-one (PubChem CID 101442370) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (4aS,11aR)-1,4,4a,5,11,11a-hexahydropyrano[4,3-c][1]benzoxepin-3-one.
| Compound Name | (4aS,11aR)-1,4,4a,5,11,11a-hexahydropyrano[4,3-c][1]benzoxepin-3-one |
|---|---|
| PubChem CID | 101442370 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (4aS,11aR)-1,4,4a,5,11,11a-hexahydropyrano[4,3-c][1]benzoxepin-3-one |
| SMILES | O=C1C[C@@H]2COc3ccccc3C[C@H]2CO1 |
| InChI | InChI=1S/C13H14O3/c14-13-6-11-7-15-12-4-2-1-3-9(12)5-10(11)8-16-13/h1-4,10-11H,5-8H2/t10-,11+/m0/s1 |
| InChIKey | RGWUNPREBRHIID-WDEREUQCSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |