C15H12O3 — CID 101032425
2-(3,4-dihydro-2H-chromen-3-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 101032425) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-3-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3,4-dihydro-2H-chromen-3-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 101032425 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-3-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(C2COc3ccccc3C2)=C1 |
| InChI | InChI=1S/C15H12O3/c16-12-5-6-14(17)13(8-12)11-7-10-3-1-2-4-15(10)18-9-11/h1-6,8,11H,7,9H2 |
| InChIKey | YNBCLEQSHUHGJL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|