C17H18O3 — CID 100986544
(3S)-3-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromene (PubChem CID 100986544) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (3S)-3-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromene.
| Compound Name | (3S)-3-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 100986544 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (3S)-3-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromene |
| SMILES | COc1ccc([C@H]2COc3ccccc3C2)cc1OC |
| InChI | InChI=1S/C17H18O3/c1-18-16-8-7-12(10-17(16)19-2)14-9-13-5-3-4-6-15(13)20-11-14/h3-8,10,14H,9,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | PWYPJIGHECXPME-CQSZACIVSA-N |
| XLogP | 3.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |