C31H30O7 — CID 70393683
[8-[dihydroxy(phenyl)methyl]-3-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-yl]-phenylmethanediol (PubChem CID 70393683) has the molecular formula C31H30O7 and a molecular weight of 514.57 g/mol. Its IUPAC name is [8-[dihydroxy(phenyl)methyl]-3-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-yl]-phenylmethanediol.
| Compound Name | [8-[dihydroxy(phenyl)methyl]-3-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-yl]-phenylmethanediol |
|---|---|
| PubChem CID | 70393683 |
| Molecular Formula | C31H30O7 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | [8-[dihydroxy(phenyl)methyl]-3-(3,4-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-yl]-phenylmethanediol |
| SMILES | COc1ccc(C2COc3c(ccc(C(O)(O)c4ccccc4)c3C(O)(O)c3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C31H30O7/c1-36-26-16-14-20(18-27(26)37-2)22-17-21-13-15-25(30(32,33)23-9-5-3-6-10-23)28(29(21)38-19-22)31(34,35)24-11-7-4-8-12-24/h3-16,18,22,32-35H,17,19H2,1-2H3 |
| InChIKey | HTABIKXKORMFGJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|