About 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid
2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 65408477) has the molecular formula C13H11NO3S
and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid.
Analyze 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid (CID 65408477) is 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(C2COc3ccccc3C2)s1.
What is the InChIKey of 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is UHGPRBZIXHGDKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3S/c15-13(16)11-6-14-12(18-11)9-5-8-3-1-2-4-10(8)17-7-9/h1-4,6,9H,5,7H2,(H,15,16).
What are the key properties of 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid?
2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 261.30 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-chromen-3-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 65408477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).