C12H12O3 — CID 96893072
(Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid (PubChem CID 96893072) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid.
| Compound Name | (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 96893072 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C\[C@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C12H12O3/c13-12(14)6-5-9-7-10-3-1-2-4-11(10)15-8-9/h1-6,9H,7-8H2,(H,13,14)/b6-5-/t9-/m1/s1 |
| InChIKey | VRORSHSQJGUNNU-SSJHQANKSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|