(Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid

C12H12O3 — CID 96893072

IUPAC(Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid
SMILESO=C(O)/C=C\[C@H]1COc2ccccc2C1
InChIInChI=1S/C12H12O3/c13-12(14)6-5-9-7-10-3-1-2-4-11(10)15-8-9/h1-6,9H,7-8H2,(H,13,14)/b6-5-/t9-/m1/s1
InChIKeyVRORSHSQJGUNNU-SSJHQANKSA-N
MW204.23 g/mol
LogP1.88
Rot. Bonds2

About (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid

(Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid (PubChem CID 96893072) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid.

Molecular Properties

Compound Name(Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid
PubChem CID96893072
Molecular FormulaC12H12O3
Molecular Weight204.23 g/mol
Exact Mass204.08
IUPAC Name(Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid
SMILESO=C(O)/C=C\[C@H]1COc2ccccc2C1
InChIInChI=1S/C12H12O3/c13-12(14)6-5-9-7-10-3-1-2-4-11(10)15-8-9/h1-6,9H,7-8H2,(H,13,14)/b6-5-/t9-/m1/s1
InChIKeyVRORSHSQJGUNNU-SSJHQANKSA-N
XLogP1.88
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.23
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid?
The IUPAC name of (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid (CID 96893072) is (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid.
What is the SMILES notation for (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid?
The canonical SMILES for (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid is O=C(O)/C=C\[C@H]1COc2ccccc2C1.
What is the InChIKey of (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid?
The InChIKey is VRORSHSQJGUNNU-SSJHQANKSA-N. The full InChI is InChI=1S/C12H12O3/c13-12(14)6-5-9-7-10-3-1-2-4-11(10)15-8-9/h1-6,9H,7-8H2,(H,13,14)/b6-5-/t9-/m1/s1.
What are the key properties of (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid?
(Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid has a molecular weight of 204.23 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]prop-2-enoic acid is sourced from PubChem (CID 96893072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).