C15H14O3 — CID 139809687
4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol (PubChem CID 139809687) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol.
| Compound Name | 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 139809687 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(C2COc3ccccc3C2)c(O)c1 |
| InChI | InChI=1S/C15H14O3/c16-12-5-6-13(14(17)8-12)11-7-10-3-1-2-4-15(10)18-9-11/h1-6,8,11,16-17H,7,9H2 |
| InChIKey | UEUUHOJGNVCWOT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |