About 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol
4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol (PubChem CID 139809687) has the molecular formula C15H14O3
and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol |
| PubChem CID | 139809687 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(C2COc3ccccc3C2)c(O)c1 |
| InChI | InChI=1S/C15H14O3/c16-12-5-6-13(14(17)8-12)11-7-10-3-1-2-4-15(10)18-9-11/h1-6,8,11,16-17H,7,9H2 |
| InChIKey | UEUUHOJGNVCWOT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol?
The IUPAC name of 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol (CID 139809687) is 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol.
What is the SMILES notation for 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol?
The canonical SMILES for 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol is Oc1ccc(C2COc3ccccc3C2)c(O)c1.
What is the InChIKey of 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol?
The InChIKey is UEUUHOJGNVCWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3/c16-12-5-6-13(14(17)8-12)11-7-10-3-1-2-4-15(10)18-9-11/h1-6,8,11,16-17H,7,9H2.
What are the key properties of 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol?
4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol has a molecular weight of 242.27 g/mol, XLogP of 2.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-2H-chromen-3-yl)benzene-1,3-diol is sourced from PubChem (CID 139809687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).