C15H14O4 — CID 52941222
4-(7-hydroxy-3,4-dihydro-2H-chromen-3-yl)benzene-1,2-diol (PubChem CID 52941222) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-(7-hydroxy-3,4-dihydro-2H-chromen-3-yl)benzene-1,2-diol.
| Compound Name | 4-(7-hydroxy-3,4-dihydro-2H-chromen-3-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 52941222 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-(7-hydroxy-3,4-dihydro-2H-chromen-3-yl)benzene-1,2-diol |
| SMILES | Oc1ccc2c(c1)OCC(c1ccc(O)c(O)c1)C2 |
| InChI | InChI=1S/C15H14O4/c16-12-3-1-10-5-11(8-19-15(10)7-12)9-2-4-13(17)14(18)6-9/h1-4,6-7,11,16-18H,5,8H2 |
| InChIKey | BXUZHRKORIBRMQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|