C20H22O9 — CID 74977156
2-[[2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 74977156) has the molecular formula C20H22O9 and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-[[2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-[[2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 74977156 |
| Molecular Formula | C20H22O9 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[[2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | Oc1ccc2c(c1)OC(c1ccc(O)c(O)c1)C(OC1OCC(O)C(O)C1O)C2 |
| InChI | InChI=1S/C20H22O9/c21-11-3-1-9-6-16(29-20-18(26)17(25)14(24)8-27-20)19(28-15(9)7-11)10-2-4-12(22)13(23)5-10/h1-5,7,14,16-26H,6,8H2 |
| InChIKey | AAXSQJZTSPDAGW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|