C21H24O10 — CID 10137895
(3S,4S,5S,6R)-2-[[(2R,3S)-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10137895) has the molecular formula C21H24O10 and a molecular weight of 436.41 g/mol. Its IUPAC name is (3S,4S,5S,6R)-2-[[(2R,3S)-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3S,4S,5S,6R)-2-[[(2R,3S)-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10137895 |
| Molecular Formula | C21H24O10 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (3S,4S,5S,6R)-2-[[(2R,3S)-2-(3,4-dihydroxyphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(O[C@H]2Cc3ccc(O)cc3O[C@@H]2c2ccc(O)c(O)c2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H24O10/c22-8-16-17(26)18(27)19(28)21(31-16)30-15-6-9-1-3-11(23)7-14(9)29-20(15)10-2-4-12(24)13(25)5-10/h1-5,7,15-28H,6,8H2/t15-,16+,17+,18-,19-,20+,21?/m0/s1 |
| InChIKey | QFYSIZOIRKKQOW-WTJSVJSYSA-N |
| XLogP | -0.34 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|