C20H22O4 — CID 162915335
4-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-2-(3-methylbut-2-enyl)benzene-1,3-diol (PubChem CID 162915335) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 4-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-2-(3-methylbut-2-enyl)benzene-1,3-diol.
| Compound Name | 4-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 162915335 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| SMILES | CC(C)=CCc1c(O)ccc([C@@H]2COc3cc(O)ccc3C2)c1O |
| InChI | InChI=1S/C20H22O4/c1-12(2)3-6-17-18(22)8-7-16(20(17)23)14-9-13-4-5-15(21)10-19(13)24-11-14/h3-5,7-8,10,14,21-23H,6,9,11H2,1-2H3/t14-/m0/s1 |
| InChIKey | KLQQHVRUXGQDHL-AWEZNQCLSA-N |
| XLogP | 4.03 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|