C21H24O3 — CID 142710940
4-[(2S)-7-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-3-(3-methylbut-2-enyl)benzene-1,2-diol (PubChem CID 142710940) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-[(2S)-7-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-3-(3-methylbut-2-enyl)benzene-1,2-diol.
| Compound Name | 4-[(2S)-7-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-3-(3-methylbut-2-enyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 142710940 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-[(2S)-7-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-3-(3-methylbut-2-enyl)benzene-1,2-diol |
| SMILES | CC(C)=CCc1c([C@H]2CCc3ccc(O)cc3C2)ccc(O)c1O |
| InChI | InChI=1S/C21H24O3/c1-13(2)3-8-19-18(9-10-20(23)21(19)24)15-5-4-14-6-7-17(22)12-16(14)11-15/h3,6-7,9-10,12,15,22-24H,4-5,8,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | BINNVDAREOTNTC-HNNXBMFYSA-N |
| XLogP | 4.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|