C13H18O2 — CID 66363239
4-(2,3-dihydro-1-benzofuran-2-yl)-3-methylbutan-2-ol (PubChem CID 66363239) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-2-yl)-3-methylbutan-2-ol.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-2-yl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 66363239 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-2-yl)-3-methylbutan-2-ol |
| SMILES | CC(O)C(C)CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C13H18O2/c1-9(10(2)14)7-12-8-11-5-3-4-6-13(11)15-12/h3-6,9-10,12,14H,7-8H2,1-2H3 |
| InChIKey | ZMHBKORTEQENEN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |