C15H22O2 — CID 66365997
5-(2,3-dihydro-1-benzofuran-2-yl)-4,4-dimethylpentan-2-ol (PubChem CID 66365997) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-2-yl)-4,4-dimethylpentan-2-ol.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-2-yl)-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 66365997 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-2-yl)-4,4-dimethylpentan-2-ol |
| SMILES | CC(O)CC(C)(C)CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C15H22O2/c1-11(16)9-15(2,3)10-13-8-12-6-4-5-7-14(12)17-13/h4-7,11,13,16H,8-10H2,1-3H3 |
| InChIKey | VJZZLDPAFYVNDQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |