About 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline
4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline (PubChem CID 66348760) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline |
| PubChem CID | 66348760 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline |
| SMILES | Cc1cc(N)cc(C)c1OCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C17H19NO2/c1-11-7-14(18)8-12(2)17(11)19-10-15-9-13-5-3-4-6-16(13)20-15/h3-8,15H,9-10,18H2,1-2H3 |
| InChIKey | KJRXWLLYBFIPLG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline?
The IUPAC name of 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline (CID 66348760) is 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline.
What is the SMILES notation for 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline?
The canonical SMILES for 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline is Cc1cc(N)cc(C)c1OCC1Cc2ccccc2O1.
What is the InChIKey of 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline?
The InChIKey is KJRXWLLYBFIPLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-11-7-14(18)8-12(2)17(11)19-10-15-9-13-5-3-4-6-16(13)20-15/h3-8,15H,9-10,18H2,1-2H3.
What are the key properties of 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline?
4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline has a molecular weight of 269.34 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1-benzofuran-2-ylmethoxy)-3,5-dimethylaniline is sourced from PubChem (CID 66348760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).