C12H14O4 — CID 104875432
(2R)-2-(2,3-dihydro-1-benzofuran-2-ylmethoxy)propanoic acid (PubChem CID 104875432) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1-benzofuran-2-ylmethoxy)propanoic acid.
| Compound Name | (2R)-2-(2,3-dihydro-1-benzofuran-2-ylmethoxy)propanoic acid |
|---|---|
| PubChem CID | 104875432 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1-benzofuran-2-ylmethoxy)propanoic acid |
| SMILES | C[C@@H](OCC1Cc2ccccc2O1)C(=O)O |
| InChI | InChI=1S/C12H14O4/c1-8(12(13)14)15-7-10-6-9-4-2-3-5-11(9)16-10/h2-5,8,10H,6-7H2,1H3,(H,13,14)/t8-,10?/m1/s1 |
| InChIKey | MFKXSDMOIZKYNC-HNHGDDPOSA-N |
| XLogP | 1.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |