C31H45ClO6 — CID 89321185
prop-2-enyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-2-[[4-[(1S)-1-hydroxybutyl]phenoxy]methyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 89321185) has the molecular formula C31H45ClO6 and a molecular weight of 549.15 g/mol. Its IUPAC name is prop-2-enyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-2-[[4-[(1S)-1-hydroxybutyl]phenoxy]methyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | prop-2-enyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-2-[[4-[(1S)-1-hydroxybutyl]phenoxy]methyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 89321185 |
| Molecular Formula | C31H45ClO6 |
| Molecular Weight | 549.15 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | prop-2-enyl (Z)-7-[(1R,2S,3R,5R)-5-chloro-2-[[4-[(1S)-1-hydroxybutyl]phenoxy]methyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | C=CCOC(=O)CCC/C=C\C[C@@H]1[C@@H](COc2ccc([C@@H](O)CCC)cc2)[C@H](OC2CCCCO2)C[C@H]1Cl |
| InChI | InChI=1S/C31H45ClO6/c1-3-11-28(33)23-15-17-24(18-16-23)37-22-26-25(12-7-5-6-8-13-30(34)35-19-4-2)27(32)21-29(26)38-31-14-9-10-20-36-31/h4-5,7,15-18,25-29,31,33H,2-3,6,8-14,19-22H2,1H3/b7-5-/t25-,26-,27-,28+,29-,31?/m1/s1 |
| InChIKey | DBENXSBYYWDIKV-BGNCRTOTSA-N |
| XLogP | 6.90 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.15 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|