C35H51ClO8 — CID 70016981
methyl (Z)-7-[(1R,2R,3R,5R)-5-chloro-2-[(E)-3-hydroxy-4-[3-(methoxymethyl)-4-(oxan-2-yloxy)phenyl]but-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 70016981) has the molecular formula C35H51ClO8 and a molecular weight of 635.24 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5R)-5-chloro-2-[(E)-3-hydroxy-4-[3-(methoxymethyl)-4-(oxan-2-yloxy)phenyl]but-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5R)-5-chloro-2-[(E)-3-hydroxy-4-[3-(methoxymethyl)-4-(oxan-2-yloxy)phenyl]but-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70016981 |
| Molecular Formula | C35H51ClO8 |
| Molecular Weight | 635.24 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5R)-5-chloro-2-[(E)-3-hydroxy-4-[3-(methoxymethyl)-4-(oxan-2-yloxy)phenyl]but-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | COCc1cc(CC(O)/C=C/[C@@H]2[C@@H](C/C=C\CCCC(=O)OC)[C@H](Cl)C[C@H]2OC2CCCCO2)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C35H51ClO8/c1-39-24-26-21-25(15-18-31(26)43-34-13-7-9-19-41-34)22-27(37)16-17-29-28(11-5-3-4-6-12-33(38)40-2)30(36)23-32(29)44-35-14-8-10-20-42-35/h3,5,15-18,21,27-30,32,34-35,37H,4,6-14,19-20,22-24H2,1-2H3/b5-3-,17-16+/t27?,28-,29-,30-,32-,34?,35?/m1/s1 |
| InChIKey | KSBPNXFMCNFDMN-ADPJYARASA-N |
| XLogP | 6.64 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.24 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|