C26H34ClNO4S — CID 91210804
7-[(1R,2R,3R,5R)-2-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxy-5-isocyanocyclopentyl]hept-5-enoic acid (PubChem CID 91210804) has the molecular formula C26H34ClNO4S and a molecular weight of 492.08 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5R)-2-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxy-5-isocyanocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5R)-2-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxy-5-isocyanocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91210804 |
| Molecular Formula | C26H34ClNO4S |
| Molecular Weight | 492.08 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 7-[(1R,2R,3R,5R)-2-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxy-5-isocyanocyclopentyl]hept-5-enoic acid |
| SMILES | [C-]#[N+][C@@H]1C[C@@H](O)[C@H](C=CCC(O)C2(Cc3ccc(Cl)s3)CCC2)[C@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C26H34ClNO4S/c1-28-21-16-22(29)20(19(21)8-4-2-3-5-11-25(31)32)9-6-10-23(30)26(14-7-15-26)17-18-12-13-24(27)33-18/h2,4,6,9,12-13,19-23,29-30H,3,5,7-8,10-11,14-17H2,(H,31,32)/t19-,20-,21-,22-,23?/m1/s1 |
| InChIKey | GCJNAXALLBXILA-CDFDCGRVSA-N |
| XLogP | 5.91 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.08 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|