C31H40ClFO4S — CID 69473642
7-[(1R,2R,3R)-2-[4-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybutyl]phenyl]-5-fluoro-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 69473642) has the molecular formula C31H40ClFO4S and a molecular weight of 563.18 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[4-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybutyl]phenyl]-5-fluoro-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[4-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybutyl]phenyl]-5-fluoro-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 69473642 |
| Molecular Formula | C31H40ClFO4S |
| Molecular Weight | 563.18 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[4-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybutyl]phenyl]-5-fluoro-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1C(F)C[C@@H](O)[C@H]1c1ccc(CCCC(O)C2(Cc3ccc(Cl)s3)CCC2)cc1 |
| InChI | InChI=1S/C31H40ClFO4S/c32-28-16-15-23(38-28)20-31(17-6-18-31)27(35)9-5-7-21-11-13-22(14-12-21)30-24(25(33)19-26(30)34)8-3-1-2-4-10-29(36)37/h1,3,11-16,24-27,30,34-35H,2,4-10,17-20H2,(H,36,37)/t24-,25?,26+,27?,30-/m0/s1 |
| InChIKey | YUKJHLAMDAHSQT-FKNQGZIOSA-N |
| XLogP | 7.50 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.18 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|