C25H33ClO4S — CID 68879627
7-[(3R)-2-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxycyclopenten-1-yl]hept-5-enoic acid (PubChem CID 68879627) has the molecular formula C25H33ClO4S and a molecular weight of 465.06 g/mol. Its IUPAC name is 7-[(3R)-2-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxycyclopenten-1-yl]hept-5-enoic acid.
| Compound Name | 7-[(3R)-2-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxycyclopenten-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 68879627 |
| Molecular Formula | C25H33ClO4S |
| Molecular Weight | 465.06 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 7-[(3R)-2-[4-[1-[(5-chlorothiophen-2-yl)methyl]cyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxycyclopenten-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CCC1=C(C=CCC(O)C2(Cc3ccc(Cl)s3)CCC2)[C@H](O)CC1 |
| InChI | InChI=1S/C25H33ClO4S/c26-23-14-12-19(31-23)17-25(15-6-16-25)22(28)9-5-8-20-18(11-13-21(20)27)7-3-1-2-4-10-24(29)30/h1,3,5,8,12,14,21-22,27-28H,2,4,6-7,9-11,13,15-17H2,(H,29,30)/t21-,22?/m1/s1 |
| InChIKey | HBCSHLUQOYHQOK-ZMFCMNQTSA-N |
| XLogP | 6.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.06 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|