C26H37NO4S — CID 59235807
7-[(1S,2R,3R,5R)-5-cyano-3-hydroxy-2-[(E)-4-hydroxy-4-[1-(thiophen-2-ylmethyl)cyclobutyl]but-1-enyl]cyclopentyl]heptanoic acid (PubChem CID 59235807) has the molecular formula C26H37NO4S and a molecular weight of 459.65 g/mol. Its IUPAC name is 7-[(1S,2R,3R,5R)-5-cyano-3-hydroxy-2-[(E)-4-hydroxy-4-[1-(thiophen-2-ylmethyl)cyclobutyl]but-1-enyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2R,3R,5R)-5-cyano-3-hydroxy-2-[(E)-4-hydroxy-4-[1-(thiophen-2-ylmethyl)cyclobutyl]but-1-enyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 59235807 |
| Molecular Formula | C26H37NO4S |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 7-[(1S,2R,3R,5R)-5-cyano-3-hydroxy-2-[(E)-4-hydroxy-4-[1-(thiophen-2-ylmethyl)cyclobutyl]but-1-enyl]cyclopentyl]heptanoic acid |
| SMILES | N#C[C@@H]1C[C@@H](O)[C@H](/C=C/CC(O)C2(Cc3cccs3)CCC2)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C26H37NO4S/c27-18-19-16-23(28)22(21(19)9-3-1-2-4-12-25(30)31)10-5-11-24(29)26(13-7-14-26)17-20-8-6-15-32-20/h5-6,8,10,15,19,21-24,28-29H,1-4,7,9,11-14,16-17H2,(H,30,31)/b10-5+/t19-,21-,22+,23+,24?/m0/s1 |
| InChIKey | CBQUPJKYCIIRCI-YAVMBKDNSA-N |
| XLogP | 5.33 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|