C25H33NO4S — CID 71090896
(Z)-7-[(1S,3R)-5-cyano-3-hydroxy-2-[(E)-4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 71090896) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is (Z)-7-[(1S,3R)-5-cyano-3-hydroxy-2-[(E)-4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,3R)-5-cyano-3-hydroxy-2-[(E)-4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 71090896 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (Z)-7-[(1S,3R)-5-cyano-3-hydroxy-2-[(E)-4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)but-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | N#CC1C[C@@H](O)C(/C=C/CC(O)C2(c3cccs3)CCC2)[C@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C25H33NO4S/c26-17-18-16-21(27)20(19(18)8-3-1-2-4-12-24(29)30)9-5-10-22(28)25(13-7-14-25)23-11-6-15-31-23/h1,3,5-6,9,11,15,18-22,27-28H,2,4,7-8,10,12-14,16H2,(H,29,30)/b3-1-,9-5+/t18?,19-,20?,21+,22?/m0/s1 |
| InChIKey | WUFUDPHYZSZFEE-NSBJEGEFSA-N |
| XLogP | 4.81 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|