C25H37NO4S — CID 143694868
7-[(1S,3R,5R)-5-cyano-3-hydroxy-2-[4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)butyl]cyclopentyl]heptanoic acid (PubChem CID 143694868) has the molecular formula C25H37NO4S and a molecular weight of 447.64 g/mol. Its IUPAC name is 7-[(1S,3R,5R)-5-cyano-3-hydroxy-2-[4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)butyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,3R,5R)-5-cyano-3-hydroxy-2-[4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)butyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 143694868 |
| Molecular Formula | C25H37NO4S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 7-[(1S,3R,5R)-5-cyano-3-hydroxy-2-[4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)butyl]cyclopentyl]heptanoic acid |
| SMILES | N#C[C@@H]1C[C@@H](O)C(CCCC(O)C2(c3cccs3)CCC2)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C25H37NO4S/c26-17-18-16-21(27)20(19(18)8-3-1-2-4-12-24(29)30)9-5-10-22(28)25(13-7-14-25)23-11-6-15-31-23/h6,11,15,18-22,27-28H,1-5,7-10,12-14,16H2,(H,29,30)/t18-,19-,20?,21+,22?/m0/s1 |
| InChIKey | XFIBGLJECINIMP-AKBOATIKSA-N |
| XLogP | 5.26 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|