C25H39NO2S — CID 143867064
heptanal;(1R)-3-[4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)butyl]cyclopentane-1-carbonitrile (PubChem CID 143867064) has the molecular formula C25H39NO2S and a molecular weight of 417.66 g/mol. Its IUPAC name is heptanal;(1R)-3-[4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)butyl]cyclopentane-1-carbonitrile.
| Compound Name | heptanal;(1R)-3-[4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)butyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 143867064 |
| Molecular Formula | C25H39NO2S |
| Molecular Weight | 417.66 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | heptanal;(1R)-3-[4-hydroxy-4-(1-thiophen-2-ylcyclobutyl)butyl]cyclopentane-1-carbonitrile |
| SMILES | CCCCCCC=O.N#C[C@@H]1CCC(CCCC(O)C2(c3cccs3)CCC2)C1 |
| InChI | InChI=1S/C18H25NOS.C7H14O/c19-13-15-8-7-14(12-15)4-1-5-16(20)18(9-3-10-18)17-6-2-11-21-17;1-2-3-4-5-6-7-8/h2,6,11,14-16,20H,1,3-5,7-10,12H2;7H,2-6H2,1H3/t14?,15-,16?;/m1./s1 |
| InChIKey | XJSXOCKTYJPHQB-RPFJJZQVSA-N |
| XLogP | 6.80 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.66 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|