C23H36O3S — CID 143860475
(E)-4-cyclopentyl-1-(1-ethylcyclobutyl)but-3-en-1-ol;5-propylthiophene-2-carboxylic acid (PubChem CID 143860475) has the molecular formula C23H36O3S and a molecular weight of 392.61 g/mol. Its IUPAC name is (E)-4-cyclopentyl-1-(1-ethylcyclobutyl)but-3-en-1-ol;5-propylthiophene-2-carboxylic acid.
| Compound Name | (E)-4-cyclopentyl-1-(1-ethylcyclobutyl)but-3-en-1-ol;5-propylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 143860475 |
| Molecular Formula | C23H36O3S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (E)-4-cyclopentyl-1-(1-ethylcyclobutyl)but-3-en-1-ol;5-propylthiophene-2-carboxylic acid |
| SMILES | CCC1(C(O)C/C=C/C2CCCC2)CCC1.CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C15H26O.C8H10O2S/c1-2-15(11-6-12-15)14(16)10-5-9-13-7-3-4-8-13;1-2-3-6-4-5-7(11-6)8(9)10/h5,9,13-14,16H,2-4,6-8,10-12H2,1H3;4-5H,2-3H2,1H3,(H,9,10)/b9-5+; |
| InChIKey | GSWNQTWZQYTVOX-SZKNIZGXSA-N |
| XLogP | 6.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|