C26H36Cl2O4S — CID 68880632
methyl 7-[(1R,2R,3R)-5-chloro-2-[4-[1-(5-chlorothiophen-2-yl)-2-methylcyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate (PubChem CID 68880632) has the molecular formula C26H36Cl2O4S and a molecular weight of 515.54 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-5-chloro-2-[4-[1-(5-chlorothiophen-2-yl)-2-methylcyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R)-5-chloro-2-[4-[1-(5-chlorothiophen-2-yl)-2-methylcyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68880632 |
| Molecular Formula | C26H36Cl2O4S |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-5-chloro-2-[4-[1-(5-chlorothiophen-2-yl)-2-methylcyclobutyl]-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@H]1C(Cl)C[C@@H](O)[C@@H]1C=CCC(O)C1(c2ccc(Cl)s2)CCC1C |
| InChI | InChI=1S/C26H36Cl2O4S/c1-17-14-15-26(17,23-12-13-24(28)33-23)22(30)10-7-9-19-18(20(27)16-21(19)29)8-5-3-4-6-11-25(31)32-2/h3,5,7,9,12-13,17-22,29-30H,4,6,8,10-11,14-16H2,1-2H3/t17?,18-,19-,20?,21-,22?,26?/m1/s1 |
| InChIKey | JNIPIWSITBOTFW-CJISZIHUSA-N |
| XLogP | 6.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|