C17H24HgO3 — CID 10027987
[(1S,2R,7R)-2-benzoyloxy-7-methoxycycloheptyl]methyl-methylmercury (PubChem CID 10027987) has the molecular formula C17H24HgO3 and a molecular weight of 476.97 g/mol. Its IUPAC name is [(1S,2R,7R)-2-benzoyloxy-7-methoxycycloheptyl]methyl-methylmercury.
| Compound Name | [(1S,2R,7R)-2-benzoyloxy-7-methoxycycloheptyl]methyl-methylmercury |
|---|---|
| PubChem CID | 10027987 |
| Molecular Formula | C17H24HgO3 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [(1S,2R,7R)-2-benzoyloxy-7-methoxycycloheptyl]methyl-methylmercury |
| SMILES | CO[C@@H]1CCCC[C@@H](OC(=O)c2ccccc2)[C@H]1C[Hg]C |
| InChI | InChI=1S/C16H21O3.CH3.Hg/c1-12-14(18-2)10-6-7-11-15(12)19-16(17)13-8-4-3-5-9-13;;/h3-5,8-9,12,14-15H,1,6-7,10-11H2,2H3;1H3;/t12-,14+,15+;;/m0../s1 |
| InChIKey | BZEIKZGOBGSPOF-MVDHWJGESA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|