C19H30N2O2 — CID 24837155
[(1R,2R)-2-[3-(dimethylamino)propyl-methylamino]cyclohexyl] benzoate (PubChem CID 24837155) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is [(1R,2R)-2-[3-(dimethylamino)propyl-methylamino]cyclohexyl] benzoate.
| Compound Name | [(1R,2R)-2-[3-(dimethylamino)propyl-methylamino]cyclohexyl] benzoate |
|---|---|
| PubChem CID | 24837155 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | [(1R,2R)-2-[3-(dimethylamino)propyl-methylamino]cyclohexyl] benzoate |
| SMILES | CN(C)CCCN(C)[C@@H]1CCCC[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H30N2O2/c1-20(2)14-9-15-21(3)17-12-7-8-13-18(17)23-19(22)16-10-5-4-6-11-16/h4-6,10-11,17-18H,7-9,12-15H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | HJUOJAYCHJBENW-QZTJIDSGSA-N |
| XLogP | 3.04 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |