C16H22NO2+ — CID 11871585
[(4R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-4-yl] benzoate (PubChem CID 11871585) has the molecular formula C16H22NO2+ and a molecular weight of 260.36 g/mol. Its IUPAC name is [(4R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-4-yl] benzoate.
| Compound Name | [(4R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-4-yl] benzoate |
|---|---|
| PubChem CID | 11871585 |
| Molecular Formula | C16H22NO2+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [(4R,4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-4-yl] benzoate |
| SMILES | O=C(O[C@@H]1CC[NH2+][C@H]2CCCC[C@@H]21)c1ccccc1 |
| InChI | InChI=1S/C16H21NO2/c18-16(12-6-2-1-3-7-12)19-15-10-11-17-14-9-5-4-8-13(14)15/h1-3,6-7,13-15,17H,4-5,8-11H2/p+1/t13-,14-,15+/m0/s1 |
| InChIKey | MHURPUBOKOVYBH-SOUVJXGZSA-O |
| XLogP | 1.74 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |