C13H16O3S — CID 88976423
O-[(2R,3R,5S)-2-(hydroxymethyl)-5-methyloxolan-3-yl] benzenecarbothioate (PubChem CID 88976423) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is O-[(2R,3R,5S)-2-(hydroxymethyl)-5-methyloxolan-3-yl] benzenecarbothioate.
| Compound Name | O-[(2R,3R,5S)-2-(hydroxymethyl)-5-methyloxolan-3-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 88976423 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | O-[(2R,3R,5S)-2-(hydroxymethyl)-5-methyloxolan-3-yl] benzenecarbothioate |
| SMILES | C[C@H]1C[C@@H](OC(=S)c2ccccc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C13H16O3S/c1-9-7-11(12(8-14)15-9)16-13(17)10-5-3-2-4-6-10/h2-6,9,11-12,14H,7-8H2,1H3/t9-,11+,12+/m0/s1 |
| InChIKey | JNDZQBGTGLPJGJ-MVWJERBFSA-N |
| XLogP | 1.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|