C19H26N3O12P-2 — CID 153317731
[(3S,4S,6S)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-benzoyloxy-3,4-dihydroxyoxan-2-yl]methyl phosphate (PubChem CID 153317731) has the molecular formula C19H26N3O12P-2 and a molecular weight of 519.40 g/mol. Its IUPAC name is [(3S,4S,6S)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-benzoyloxy-3,4-dihydroxyoxan-2-yl]methyl phosphate.
| Compound Name | [(3S,4S,6S)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-benzoyloxy-3,4-dihydroxyoxan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 153317731 |
| Molecular Formula | C19H26N3O12P-2 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | [(3S,4S,6S)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-5-benzoyloxy-3,4-dihydroxyoxan-2-yl]methyl phosphate |
| SMILES | [N-]=[N+]=NCCOCCOCCO[C@H]1OC(COP(=O)([O-])[O-])[C@@H](O)[C@H](O)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H28N3O12P/c20-22-21-6-7-29-8-9-30-10-11-31-19-17(34-18(25)13-4-2-1-3-5-13)16(24)15(23)14(33-19)12-32-35(26,27)28/h1-5,14-17,19,23-24H,6-12H2,(H2,26,27,28)/p-2/t14?,15-,16+,17?,19+/m1/s1 |
| InChIKey | KRLOQLQRNBEFAV-SIQTUAQCSA-L |
| XLogP | -1.14 |
| TPSA | 224.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|