C23H24O6 — CID 123793228
(4-benzoyloxy-6-prop-2-enoxyoxan-2-yl)methyl benzoate (PubChem CID 123793228) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is (4-benzoyloxy-6-prop-2-enoxyoxan-2-yl)methyl benzoate.
| Compound Name | (4-benzoyloxy-6-prop-2-enoxyoxan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 123793228 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (4-benzoyloxy-6-prop-2-enoxyoxan-2-yl)methyl benzoate |
| SMILES | C=CCOC1CC(OC(=O)c2ccccc2)CC(COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C23H24O6/c1-2-13-26-21-15-19(29-23(25)18-11-7-4-8-12-18)14-20(28-21)16-27-22(24)17-9-5-3-6-10-17/h2-12,19-21H,1,13-16H2 |
| InChIKey | SFMAZZXTBGWXLC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|