C27H25NO8 — CID 10907120
[(3R,4R,5S,6R,7S)-5,6-dibenzoyloxy-3,7-dihydroxyazepan-4-yl] benzoate (PubChem CID 10907120) has the molecular formula C27H25NO8 and a molecular weight of 491.50 g/mol. Its IUPAC name is [(3R,4R,5S,6R,7S)-5,6-dibenzoyloxy-3,7-dihydroxyazepan-4-yl] benzoate.
| Compound Name | [(3R,4R,5S,6R,7S)-5,6-dibenzoyloxy-3,7-dihydroxyazepan-4-yl] benzoate |
|---|---|
| PubChem CID | 10907120 |
| Molecular Formula | C27H25NO8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | [(3R,4R,5S,6R,7S)-5,6-dibenzoyloxy-3,7-dihydroxyazepan-4-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](O)NC[C@@H](O)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO8/c29-20-16-28-24(30)23(36-27(33)19-14-8-3-9-15-19)22(35-26(32)18-12-6-2-7-13-18)21(20)34-25(31)17-10-4-1-5-11-17/h1-15,20-24,28-30H,16H2/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | SVPQFJQXZGDXKP-SJSRKZJXSA-N |
| XLogP | 1.95 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|