C27H25NO7 — CID 11005266
[(3S,4R,5R,6R)-4,5-dibenzoyloxy-6-hydroxyazepan-3-yl] benzoate (PubChem CID 11005266) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-4,5-dibenzoyloxy-6-hydroxyazepan-3-yl] benzoate.
| Compound Name | [(3S,4R,5R,6R)-4,5-dibenzoyloxy-6-hydroxyazepan-3-yl] benzoate |
|---|---|
| PubChem CID | 11005266 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [(3S,4R,5R,6R)-4,5-dibenzoyloxy-6-hydroxyazepan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)CNC[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C27H25NO7/c29-21-16-28-17-22(33-25(30)18-10-4-1-5-11-18)24(35-27(32)20-14-8-3-9-15-20)23(21)34-26(31)19-12-6-2-7-13-19/h1-15,21-24,28-29H,16-17H2/t21-,22+,23-,24-/m1/s1 |
| InChIKey | CMMBYLKQWKDOGE-UEQSERJNSA-N |
| XLogP | 2.63 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|