C27H30O7 — CID 102044692
(2S,3R,4S,5S,6S)-2-(4-methoxyphenyl)peroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-ol (PubChem CID 102044692) has the molecular formula C27H30O7 and a molecular weight of 466.53 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-(4-methoxyphenyl)peroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-ol.
| Compound Name | (2S,3R,4S,5S,6S)-2-(4-methoxyphenyl)peroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 102044692 |
| Molecular Formula | C27H30O7 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-(4-methoxyphenyl)peroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-ol |
| SMILES | COc1ccc(OO[C@@H]2O[C@@H](C)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2O)cc1 |
| InChI | InChI=1S/C27H30O7/c1-19-25(30-17-20-9-5-3-6-10-20)26(31-18-21-11-7-4-8-12-21)24(28)27(32-19)34-33-23-15-13-22(29-2)14-16-23/h3-16,19,24-28H,17-18H2,1-2H3/t19-,24+,25-,26-,27-/m0/s1 |
| InChIKey | XWVCTYFBXMYYGY-AMHVUCMBSA-N |
| XLogP | 4.28 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|