C26H40Cl3NO9Si — CID 58982608
benzyl 3-[(2R,4R,5R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-methylpropanoate (PubChem CID 58982608) has the molecular formula C26H40Cl3NO9Si and a molecular weight of 645.05 g/mol. Its IUPAC name is benzyl 3-[(2R,4R,5R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-methylpropanoate.
| Compound Name | benzyl 3-[(2R,4R,5R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 58982608 |
| Molecular Formula | C26H40Cl3NO9Si |
| Molecular Weight | 645.05 g/mol |
| Exact Mass | 643.15 |
| IUPAC Name | benzyl 3-[(2R,4R,5R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-methylpropanoate |
| SMILES | CC(CO[C@@H]1OC(CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)C1NC(=O)OCC(Cl)(Cl)Cl)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H40Cl3NO9Si/c1-16(22(33)35-13-17-10-8-7-9-11-17)12-36-23-19(30-24(34)37-15-26(27,28)29)21(32)20(31)18(39-23)14-38-40(5,6)25(2,3)4/h7-11,16,18-21,23,31-32H,12-15H2,1-6H3,(H,30,34)/t16?,18?,19?,20-,21+,23+/m0/s1 |
| InChIKey | ZTSVNDKMIKFVJC-KBHZIQOQSA-N |
| XLogP | 4.32 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.05 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|