C37H46N4O9Si — CID 11828671
benzyl (2S)-3-[(2S,3R,4R,5R,6R)-3-azido-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 11828671) has the molecular formula C37H46N4O9Si and a molecular weight of 718.88 g/mol. Its IUPAC name is benzyl (2S)-3-[(2S,3R,4R,5R,6R)-3-azido-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | benzyl (2S)-3-[(2S,3R,4R,5R,6R)-3-azido-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 11828671 |
| Molecular Formula | C37H46N4O9Si |
| Molecular Weight | 718.88 g/mol |
| Exact Mass | 718.30 |
| IUPAC Name | benzyl (2S)-3-[(2S,3R,4R,5R,6R)-3-azido-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxyoxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OCc2ccccc2)[C@H](N=[N+]=[N-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C37H46N4O9Si/c1-37(2,3)51(4,5)49-22-30-32(42)33(43)31(40-41-38)35(50-30)47-21-29(34(44)46-19-23-13-7-6-8-14-23)39-36(45)48-20-28-26-17-11-9-15-24(26)25-16-10-12-18-27(25)28/h6-18,28-33,35,42-43H,19-22H2,1-5H3,(H,39,45)/t29-,30+,31+,32-,33+,35-/m0/s1 |
| InChIKey | DJFOTSBVXQZGNC-AGAUYENESA-N |
| XLogP | 5.80 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.88 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|