C42H41Cl3N4O11 — CID 10819487
benzyl (2S)-3-[(2S,3R,4R,5R,6R)-4,5-diacetyloxy-3-azido-6-(trityloxymethyl)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate (PubChem CID 10819487) has the molecular formula C42H41Cl3N4O11 and a molecular weight of 884.17 g/mol. Its IUPAC name is benzyl (2S)-3-[(2S,3R,4R,5R,6R)-4,5-diacetyloxy-3-azido-6-(trityloxymethyl)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate.
| Compound Name | benzyl (2S)-3-[(2S,3R,4R,5R,6R)-4,5-diacetyloxy-3-azido-6-(trityloxymethyl)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10819487 |
| Molecular Formula | C42H41Cl3N4O11 |
| Molecular Weight | 884.17 g/mol |
| Exact Mass | 882.18 |
| IUPAC Name | benzyl (2S)-3-[(2S,3R,4R,5R,6R)-4,5-diacetyloxy-3-azido-6-(trityloxymethyl)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](N=[N+]=[N-])[C@@H](OC[C@H](NC(=O)OCC(Cl)(Cl)Cl)C(=O)OCc2ccccc2)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C42H41Cl3N4O11/c1-27(50)58-36-34(25-57-42(30-17-9-4-10-18-30,31-19-11-5-12-20-31)32-21-13-6-14-22-32)60-39(35(48-49-46)37(36)59-28(2)51)55-24-33(47-40(53)56-26-41(43,44)45)38(52)54-23-29-15-7-3-8-16-29/h3-22,33-37,39H,23-26H2,1-2H3,(H,47,53)/t33-,34+,35+,36-,37+,39-/m0/s1 |
| InChIKey | DDEJHQXPZZSOAC-GITHIUCRSA-N |
| XLogP | 7.49 |
| TPSA | 193.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.17 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|