C28H40Cl6N2O11Si — CID 162525078
benzyl (2R)-3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate (PubChem CID 162525078) has the molecular formula C28H40Cl6N2O11Si and a molecular weight of 821.43 g/mol. Its IUPAC name is benzyl (2R)-3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate.
| Compound Name | benzyl (2R)-3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 162525078 |
| Molecular Formula | C28H40Cl6N2O11Si |
| Molecular Weight | 821.43 g/mol |
| Exact Mass | 818.05 |
| IUPAC Name | benzyl (2R)-3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-(2,2,2-trichloroethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(OC[C@@H](NC(=O)OCC(Cl)(Cl)Cl)C(=O)OCc2ccccc2)C(NC(=O)OCC(Cl)(Cl)Cl)C(O)C1O |
| InChI | InChI=1S/C28H40Cl6N2O11Si/c1-26(2,3)48(4,5)46-13-18-20(37)21(38)19(36-25(41)45-15-28(32,33)34)23(47-18)43-12-17(35-24(40)44-14-27(29,30)31)22(39)42-11-16-9-7-6-8-10-16/h6-10,17-21,23,37-38H,11-15H2,1-5H3,(H,35,40)(H,36,41)/t17-,18?,19?,20?,21?,23?/m1/s1 |
| InChIKey | HDGUMPRIPBUCBK-BBEXFNLESA-N |
| XLogP | 5.14 |
| TPSA | 171.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|